C17H19FN6O2 — CID 171130993
5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]furan-2-carboxamide (PubChem CID 171130993) has the molecular formula C17H19FN6O2 and a molecular weight of 358.38 g/mol. Its IUPAC name is 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 171130993 |
| Molecular Formula | C17H19FN6O2 |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]furan-2-carboxamide |
| SMILES | Cc1cc(C)n(Cc2ccc(C(=O)NN=Cc3c(C)nn(C)c3F)o2)n1 |
| InChI | InChI=1S/C17H19FN6O2/c1-10-7-11(2)24(21-10)9-13-5-6-15(26-13)17(25)20-19-8-14-12(3)22-23(4)16(14)18/h5-8H,9H2,1-4H3,(H,20,25) |
| InChIKey | KTQBPGRDAUSQKS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|