C20H21FN4O3 — CID 119055968
5-[(2,4-dimethylphenoxy)methyl]-N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]furan-2-carboxamide (PubChem CID 119055968) has the molecular formula C20H21FN4O3 and a molecular weight of 384.41 g/mol. Its IUPAC name is 5-[(2,4-dimethylphenoxy)methyl]-N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[(2,4-dimethylphenoxy)methyl]-N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 119055968 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 5-[(2,4-dimethylphenoxy)methyl]-N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]furan-2-carboxamide |
| SMILES | Cc1ccc(OCc2ccc(C(=O)N/N=C/c3c(C)nn(C)c3F)o2)c(C)c1 |
| InChI | InChI=1S/C20H21FN4O3/c1-12-5-7-17(13(2)9-12)27-11-15-6-8-18(28-15)20(26)23-22-10-16-14(3)24-25(4)19(16)21/h5-10H,11H2,1-4H3,(H,23,26)/b22-10+ |
| InChIKey | CQGDQCPKEWRJRA-LSHDLFTRSA-N |
| XLogP | 3.42 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|