C18H16ClFN4O2 — CID 1009184
5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[(2-fluorophenyl)methylideneamino]furan-2-carboxamide (PubChem CID 1009184) has the molecular formula C18H16ClFN4O2 and a molecular weight of 374.80 g/mol. Its IUPAC name is 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[(2-fluorophenyl)methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[(2-fluorophenyl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 1009184 |
| Molecular Formula | C18H16ClFN4O2 |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-[(2-fluorophenyl)methylideneamino]furan-2-carboxamide |
| SMILES | Cc1nn(Cc2ccc(C(=O)NN=Cc3ccccc3F)o2)c(C)c1Cl |
| InChI | InChI=1S/C18H16ClFN4O2/c1-11-17(19)12(2)24(23-11)10-14-7-8-16(26-14)18(25)22-21-9-13-5-3-4-6-15(13)20/h3-9H,10H2,1-2H3,(H,22,25) |
| InChIKey | ZKFQFLKKBRBYIN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|