C16H22ClN3O3 — CID 19448582
5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(3-ethoxypropyl)furan-2-carboxamide (PubChem CID 19448582) has the molecular formula C16H22ClN3O3 and a molecular weight of 339.82 g/mol. Its IUPAC name is 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(3-ethoxypropyl)furan-2-carboxamide.
| Compound Name | 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(3-ethoxypropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19448582 |
| Molecular Formula | C16H22ClN3O3 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(3-ethoxypropyl)furan-2-carboxamide |
| SMILES | CCOCCCNC(=O)c1ccc(Cn2nc(C)c(Cl)c2C)o1 |
| InChI | InChI=1S/C16H22ClN3O3/c1-4-22-9-5-8-18-16(21)14-7-6-13(23-14)10-20-12(3)15(17)11(2)19-20/h6-7H,4-5,8-10H2,1-3H3,(H,18,21) |
| InChIKey | SBRBNUOVPXKJDM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|