sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate

C11H11N2NaO3 — CID 19616340

IUPACsodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate
SMILESCc1cc(C)n(Cc2ccc(C(=O)[O-])o2)n1.[Na+]
InChIInChI=1S/C11H12N2O3.Na/c1-7-5-8(2)13(12-7)6-9-3-4-10(16-9)11(14)15;/h3-5H,6H2,1-2H3,(H,14,15);/q;+1/p-1
InChIKeyUBUAXCUSFOGENQ-UHFFFAOYSA-M
MW242.21 g/mol
LogP-2.49
Rot. Bonds3

About sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate

sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate (PubChem CID 19616340) has the molecular formula C11H11N2NaO3 and a molecular weight of 242.21 g/mol. Its IUPAC name is sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate.

Molecular Properties

Compound Namesodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate
PubChem CID19616340
Molecular FormulaC11H11N2NaO3
Molecular Weight242.21 g/mol
Exact Mass242.07
IUPAC Namesodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate
SMILESCc1cc(C)n(Cc2ccc(C(=O)[O-])o2)n1.[Na+]
InChIInChI=1S/C11H12N2O3.Na/c1-7-5-8(2)13(12-7)6-9-3-4-10(16-9)11(14)15;/h3-5H,6H2,1-2H3,(H,14,15);/q;+1/p-1
InChIKeyUBUAXCUSFOGENQ-UHFFFAOYSA-M
XLogP-2.49
TPSA71.09 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.21
LogP ≤ 5-2.49
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate?
The IUPAC name of sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate (CID 19616340) is sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate.
What is the SMILES notation for sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate?
The canonical SMILES for sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate is Cc1cc(C)n(Cc2ccc(C(=O)[O-])o2)n1.[Na+].
What is the InChIKey of sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate?
The InChIKey is UBUAXCUSFOGENQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H12N2O3.Na/c1-7-5-8(2)13(12-7)6-9-3-4-10(16-9)11(14)15;/h3-5H,6H2,1-2H3,(H,14,15);/q;+1/p-1.
What are the key properties of sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate?
sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate has a molecular weight of 242.21 g/mol, XLogP of -2.49, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate is sourced from PubChem (CID 19616340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).