C11H11N2NaO3 — CID 19616340
sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate (PubChem CID 19616340) has the molecular formula C11H11N2NaO3 and a molecular weight of 242.21 g/mol. Its IUPAC name is sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate.
| Compound Name | sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 19616340 |
| Molecular Formula | C11H11N2NaO3 |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | sodium 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylate |
| SMILES | Cc1cc(C)n(Cc2ccc(C(=O)[O-])o2)n1.[Na+] |
| InChI | InChI=1S/C11H12N2O3.Na/c1-7-5-8(2)13(12-7)6-9-3-4-10(16-9)11(14)15;/h3-5H,6H2,1-2H3,(H,14,15);/q;+1/p-1 |
| InChIKey | UBUAXCUSFOGENQ-UHFFFAOYSA-M |
| XLogP | -2.49 |
| TPSA | 71.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |