C18H12F7N3O2 — CID 19466107
5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 19466107) has the molecular formula C18H12F7N3O2 and a molecular weight of 435.30 g/mol. Its IUPAC name is 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19466107 |
| Molecular Formula | C18H12F7N3O2 |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | Cc1cc(C)n(Cc2ccc(C(=O)Nc3c(F)c(F)c(C(F)(F)F)c(F)c3F)o2)n1 |
| InChI | InChI=1S/C18H12F7N3O2/c1-7-5-8(2)28(27-7)6-9-3-4-10(30-9)17(29)26-16-14(21)12(19)11(18(23,24)25)13(20)15(16)22/h3-5H,6H2,1-2H3,(H,26,29) |
| InChIKey | PYBIOQOBDOTSIF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|