C13H14BrFN4OS — CID 171131019
4-bromo-5-ethyl-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]thiophene-2-carboxamide (PubChem CID 171131019) has the molecular formula C13H14BrFN4OS and a molecular weight of 373.25 g/mol. Its IUPAC name is 4-bromo-5-ethyl-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]thiophene-2-carboxamide.
| Compound Name | 4-bromo-5-ethyl-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 171131019 |
| Molecular Formula | C13H14BrFN4OS |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 4-bromo-5-ethyl-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]thiophene-2-carboxamide |
| SMILES | CCc1sc(C(=O)NN=Cc2c(C)nn(C)c2F)cc1Br |
| InChI | InChI=1S/C13H14BrFN4OS/c1-4-10-9(14)5-11(21-10)13(20)17-16-6-8-7(2)18-19(3)12(8)15/h5-6H,4H2,1-3H3,(H,17,20) |
| InChIKey | DBFMFPQBLSXMMX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|