C10H10FN7O3 — CID 171130891
N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 171130891) has the molecular formula C10H10FN7O3 and a molecular weight of 295.23 g/mol. Its IUPAC name is N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 171130891 |
| Molecular Formula | C10H10FN7O3 |
| Molecular Weight | 295.23 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(F)c1C=NNC(=O)c1[nH]ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10FN7O3/c1-5-6(9(11)17(2)16-5)3-12-15-10(19)8-7(18(20)21)4-13-14-8/h3-4H,1-2H3,(H,13,14)(H,15,19) |
| InChIKey | CWSYNFABJPENBE-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 131.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|