C10H12N6O3 — CID 19479545
N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 19479545) has the molecular formula C10H12N6O3 and a molecular weight of 264.24 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19479545 |
| Molecular Formula | C10H12N6O3 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | Cc1nn(C)cc1CNC(=O)c1[nH]ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12N6O3/c1-6-7(5-15(2)14-6)3-11-10(17)9-8(16(18)19)4-12-13-9/h4-5H,3H2,1-2H3,(H,11,17)(H,12,13) |
| InChIKey | LGJPUXBBRFXDFI-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|