C10H19N3O — CID 142558548
N-[(1,3-dimethylpyrazol-4-yl)methyl]acetamide;ethane (PubChem CID 142558548) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazol-4-yl)methyl]acetamide;ethane.
| Compound Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]acetamide;ethane |
|---|---|
| PubChem CID | 142558548 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]acetamide;ethane |
| SMILES | CC.CC(=O)NCc1cn(C)nc1C |
| InChI | InChI=1S/C8H13N3O.C2H6/c1-6-8(4-9-7(2)12)5-11(3)10-6;1-2/h5H,4H2,1-3H3,(H,9,12);1-2H3 |
| InChIKey | IPOXOOOFNXUKMR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |