C10H15N5O — CID 112669044
N-(cyanomethyl)-2-[(1,3-dimethylpyrazol-4-yl)methylamino]acetamide (PubChem CID 112669044) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[(1,3-dimethylpyrazol-4-yl)methylamino]acetamide.
| Compound Name | N-(cyanomethyl)-2-[(1,3-dimethylpyrazol-4-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 112669044 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | N-(cyanomethyl)-2-[(1,3-dimethylpyrazol-4-yl)methylamino]acetamide |
| SMILES | Cc1nn(C)cc1CNCC(=O)NCC#N |
| InChI | InChI=1S/C10H15N5O/c1-8-9(7-15(2)14-8)5-12-6-10(16)13-4-3-11/h7,12H,4-6H2,1-2H3,(H,13,16) |
| InChIKey | DIUZOXBQMRQIAC-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|