4-[(1,3-dimethylpyrazol-4-yl)methylamino]butanoic acid

C10H17N3O2 — CID 83088801

IUPAC4-[(1,3-dimethylpyrazol-4-yl)methylamino]butanoic acid
SMILESCc1nn(C)cc1CNCCCC(=O)O
InChIInChI=1S/C10H17N3O2/c1-8-9(7-13(2)12-8)6-11-5-3-4-10(14)15/h7,11H,3-6H2,1-2H3,(H,14,15)
InChIKeyDXHLOBRSTQVNGN-UHFFFAOYSA-N
MW211.26 g/mol
LogP0.68
Rot. Bonds6

About 4-[(1,3-dimethylpyrazol-4-yl)methylamino]butanoic acid

4-[(1,3-dimethylpyrazol-4-yl)methylamino]butanoic acid (PubChem CID 83088801) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-[(1,3-dimethylpyrazol-4-yl)methylamino]butanoic acid.

Molecular Properties

Compound Name4-[(1,3-dimethylpyrazol-4-yl)methylamino]butanoic acid
PubChem CID83088801
Molecular FormulaC10H17N3O2
Molecular Weight211.26 g/mol
Exact Mass211.13
IUPAC Name4-[(1,3-dimethylpyrazol-4-yl)methylamino]butanoic acid
SMILESCc1nn(C)cc1CNCCCC(=O)O
InChIInChI=1S/C10H17N3O2/c1-8-9(7-13(2)12-8)6-11-5-3-4-10(14)15/h7,11H,3-6H2,1-2H3,(H,14,15)
InChIKeyDXHLOBRSTQVNGN-UHFFFAOYSA-N
XLogP0.68
TPSA67.15 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.26
LogP ≤ 50.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[(1,3-dimethylpyrazol-4-yl)methylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(1,3-dimethylpyrazol-4-yl)methylamino]butanoic acid?
The IUPAC name of 4-[(1,3-dimethylpyrazol-4-yl)methylamino]butanoic acid (CID 83088801) is 4-[(1,3-dimethylpyrazol-4-yl)methylamino]butanoic acid.
What is the SMILES notation for 4-[(1,3-dimethylpyrazol-4-yl)methylamino]butanoic acid?
The canonical SMILES for 4-[(1,3-dimethylpyrazol-4-yl)methylamino]butanoic acid is Cc1nn(C)cc1CNCCCC(=O)O.
What is the InChIKey of 4-[(1,3-dimethylpyrazol-4-yl)methylamino]butanoic acid?
The InChIKey is DXHLOBRSTQVNGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-8-9(7-13(2)12-8)6-11-5-3-4-10(14)15/h7,11H,3-6H2,1-2H3,(H,14,15).
What are the key properties of 4-[(1,3-dimethylpyrazol-4-yl)methylamino]butanoic acid?
4-[(1,3-dimethylpyrazol-4-yl)methylamino]butanoic acid has a molecular weight of 211.26 g/mol, XLogP of 0.68, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,3-dimethylpyrazol-4-yl)methylamino]butanoic acid is sourced from PubChem (CID 83088801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).