C16H31N3 — CID 83089811
N-[(1,3-dimethylpyrazol-4-yl)methyl]decan-1-amine (PubChem CID 83089811) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazol-4-yl)methyl]decan-1-amine.
| Compound Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]decan-1-amine |
|---|---|
| PubChem CID | 83089811 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]decan-1-amine |
| SMILES | CCCCCCCCCCNCc1cn(C)nc1C |
| InChI | InChI=1S/C16H31N3/c1-4-5-6-7-8-9-10-11-12-17-13-16-14-19(3)18-15(16)2/h14,17H,4-13H2,1-3H3 |
| InChIKey | MKAKHPJNJDXZEO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|