C9H14N4 — CID 83085525
3-[(1,3-dimethylpyrazol-4-yl)methylamino]propanenitrile (PubChem CID 83085525) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 3-[(1,3-dimethylpyrazol-4-yl)methylamino]propanenitrile.
| Compound Name | 3-[(1,3-dimethylpyrazol-4-yl)methylamino]propanenitrile |
|---|---|
| PubChem CID | 83085525 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 3-[(1,3-dimethylpyrazol-4-yl)methylamino]propanenitrile |
| SMILES | Cc1nn(C)cc1CNCCC#N |
| InChI | InChI=1S/C9H14N4/c1-8-9(7-13(2)12-8)6-11-5-3-4-10/h7,11H,3,5-6H2,1-2H3 |
| InChIKey | HQELSDLKGLAMDS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|