C8H12N4 — CID 112669035
2-[(1,3-dimethylpyrazol-4-yl)methylamino]acetonitrile (PubChem CID 112669035) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-[(1,3-dimethylpyrazol-4-yl)methylamino]acetonitrile.
| Compound Name | 2-[(1,3-dimethylpyrazol-4-yl)methylamino]acetonitrile |
|---|---|
| PubChem CID | 112669035 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 2-[(1,3-dimethylpyrazol-4-yl)methylamino]acetonitrile |
| SMILES | Cc1nn(C)cc1CNCC#N |
| InChI | InChI=1S/C8H12N4/c1-7-8(5-10-4-3-9)6-12(2)11-7/h6,10H,4-5H2,1-2H3 |
| InChIKey | VEZIBGSOMYGSHR-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|