C11H19N3O2 — CID 103263035
5-[(1,3-dimethylpyrazol-4-yl)methylamino]pentanoic acid (PubChem CID 103263035) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 5-[(1,3-dimethylpyrazol-4-yl)methylamino]pentanoic acid.
| Compound Name | 5-[(1,3-dimethylpyrazol-4-yl)methylamino]pentanoic acid |
|---|---|
| PubChem CID | 103263035 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 5-[(1,3-dimethylpyrazol-4-yl)methylamino]pentanoic acid |
| SMILES | Cc1nn(C)cc1CNCCCCC(=O)O |
| InChI | InChI=1S/C11H19N3O2/c1-9-10(8-14(2)13-9)7-12-6-4-3-5-11(15)16/h8,12H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | NVAILOSZBHBWTM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|