C11H18ClN3O — CID 112668674
5-chloro-N-[(1,3-dimethylpyrazol-4-yl)methyl]pentanamide (PubChem CID 112668674) has the molecular formula C11H18ClN3O and a molecular weight of 243.74 g/mol. Its IUPAC name is 5-chloro-N-[(1,3-dimethylpyrazol-4-yl)methyl]pentanamide.
| Compound Name | 5-chloro-N-[(1,3-dimethylpyrazol-4-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 112668674 |
| Molecular Formula | C11H18ClN3O |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 5-chloro-N-[(1,3-dimethylpyrazol-4-yl)methyl]pentanamide |
| SMILES | Cc1nn(C)cc1CNC(=O)CCCCCl |
| InChI | InChI=1S/C11H18ClN3O/c1-9-10(8-15(2)14-9)7-13-11(16)5-3-4-6-12/h8H,3-7H2,1-2H3,(H,13,16) |
| InChIKey | PKNSSFUOXGLDDQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|