C11H19N3O — CID 42352342
N-[(1,3-dimethylpyrazol-4-yl)methyl]pentanamide (PubChem CID 42352342) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazol-4-yl)methyl]pentanamide.
| Compound Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 42352342 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]pentanamide |
| SMILES | CCCCC(=O)NCc1cn(C)nc1C |
| InChI | InChI=1S/C11H19N3O/c1-4-5-6-11(15)12-7-10-8-14(3)13-9(10)2/h8H,4-7H2,1-3H3,(H,12,15) |
| InChIKey | NUADVKGJWCUCOF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |