C11H19N3O2 — CID 83089230
ethyl 3-[(1,3-dimethylpyrazol-4-yl)methylamino]propanoate (PubChem CID 83089230) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is ethyl 3-[(1,3-dimethylpyrazol-4-yl)methylamino]propanoate.
| Compound Name | ethyl 3-[(1,3-dimethylpyrazol-4-yl)methylamino]propanoate |
|---|---|
| PubChem CID | 83089230 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | ethyl 3-[(1,3-dimethylpyrazol-4-yl)methylamino]propanoate |
| SMILES | CCOC(=O)CCNCc1cn(C)nc1C |
| InChI | InChI=1S/C11H19N3O2/c1-4-16-11(15)5-6-12-7-10-8-14(3)13-9(10)2/h8,12H,4-7H2,1-3H3 |
| InChIKey | HBONHXPZUBXNQB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|