C8H15N5 — CID 112670222
1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methylguanidine (PubChem CID 112670222) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 112670222 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 1-[(1,3-dimethylpyrazol-4-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCc1cn(C)nc1C |
| InChI | InChI=1S/C8H15N5/c1-6-7(5-13(3)12-6)4-11-8(9)10-2/h5H,4H2,1-3H3,(H3,9,10,11) |
| InChIKey | KGCLHPXWUBDAOW-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|