C13H14N4O5 — CID 19579644
N-[(3,4-dimethoxyphenyl)methyl]-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 19579644) has the molecular formula C13H14N4O5 and a molecular weight of 306.28 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19579644 |
| Molecular Formula | C13H14N4O5 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2[nH]ncc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C13H14N4O5/c1-21-10-4-3-8(5-11(10)22-2)6-14-13(18)12-9(17(19)20)7-15-16-12/h3-5,7H,6H2,1-2H3,(H,14,18)(H,15,16) |
| InChIKey | UDPUFQVRVQKPPE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|