C14H16N4O4 — CID 91652580
3-methoxy-4-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-5-nitrobenzamide (PubChem CID 91652580) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is 3-methoxy-4-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-5-nitrobenzamide.
| Compound Name | 3-methoxy-4-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 91652580 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-methoxy-4-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-5-nitrobenzamide |
| SMILES | COc1cc(C(=O)NCc2cn[nH]c2C)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C14H16N4O4/c1-8-12(18(20)21)4-10(5-13(8)22-3)14(19)15-6-11-7-16-17-9(11)2/h4-5,7H,6H2,1-3H3,(H,15,19)(H,16,17) |
| InChIKey | SMMSLFSOQGDFCV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|