C13H16FN7O3 — CID 119055877
N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-3-(5-methyl-3-nitropyrazol-1-yl)propanamide (PubChem CID 119055877) has the molecular formula C13H16FN7O3 and a molecular weight of 337.32 g/mol. Its IUPAC name is N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-3-(5-methyl-3-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-3-(5-methyl-3-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 119055877 |
| Molecular Formula | C13H16FN7O3 |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-3-(5-methyl-3-nitropyrazol-1-yl)propanamide |
| SMILES | Cc1nn(C)c(F)c1/C=N/NC(=O)CCn1nc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C13H16FN7O3/c1-8-6-11(21(23)24)18-20(8)5-4-12(22)16-15-7-10-9(2)17-19(3)13(10)14/h6-7H,4-5H2,1-3H3,(H,16,22)/b15-7+ |
| InChIKey | BLYMQHUVEJYFMH-VIZOYTHASA-N |
| XLogP | 0.82 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|