C11H10FN5O3S — CID 124848723
N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide (PubChem CID 124848723) has the molecular formula C11H10FN5O3S and a molecular weight of 311.30 g/mol. Its IUPAC name is N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 124848723 |
| Molecular Formula | C11H10FN5O3S |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1CC(=O)N/N=C\c1ccc(F)s1 |
| InChI | InChI=1S/C11H10FN5O3S/c1-7-4-10(17(19)20)15-16(7)6-11(18)14-13-5-8-2-3-9(12)21-8/h2-5H,6H2,1H3,(H,14,18)/b13-5- |
| InChIKey | NHOLEYWGZPDYOE-ACAGNQJTSA-N |
| XLogP | 1.45 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|