C17H16N6O5 — CID 5195767
N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide (PubChem CID 5195767) has the molecular formula C17H16N6O5 and a molecular weight of 384.35 g/mol. Its IUPAC name is N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 5195767 |
| Molecular Formula | C17H16N6O5 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide |
| SMILES | CC(CN1C(=O)c2ccccc2C1=O)=NNC(=O)Cn1nc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C17H16N6O5/c1-10(8-21-16(25)12-5-3-4-6-13(12)17(21)26)18-19-15(24)9-22-11(2)7-14(20-22)23(27)28/h3-7H,8-9H2,1-2H3,(H,19,24) |
| InChIKey | XAIIRSHNOXKXSD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 139.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|