C13H14FN5O3S — CID 171130806
3-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(5-fluorothiophen-2-yl)methylideneamino]propanamide (PubChem CID 171130806) has the molecular formula C13H14FN5O3S and a molecular weight of 339.35 g/mol. Its IUPAC name is 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(5-fluorothiophen-2-yl)methylideneamino]propanamide.
| Compound Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(5-fluorothiophen-2-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 171130806 |
| Molecular Formula | C13H14FN5O3S |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(5-fluorothiophen-2-yl)methylideneamino]propanamide |
| SMILES | Cc1nn(CCC(=O)NN=Cc2ccc(F)s2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14FN5O3S/c1-8-13(19(21)22)9(2)18(17-8)6-5-12(20)16-15-7-10-3-4-11(14)23-10/h3-4,7H,5-6H2,1-2H3,(H,16,20) |
| InChIKey | UPIRAJYMUIBGRC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|