C17H14Cl2N2O — CID 7452524
cis-(1S,2R)-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 7452524) has the molecular formula C17H14Cl2N2O and a molecular weight of 333.22 g/mol. Its IUPAC name is cis-(1S,2R)-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7452524 |
| Molecular Formula | C17H14Cl2N2O |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | cis-(1S,2R)-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(N/N=C\c1c(Cl)cccc1Cl)[C@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H14Cl2N2O/c18-15-7-4-8-16(19)14(15)10-20-21-17(22)13-9-12(13)11-5-2-1-3-6-11/h1-8,10,12-13H,9H2,(H,21,22)/b20-10-/t12-,13-/m0/s1 |
| InChIKey | USJAPFRTULEOHI-XTMYOEJOSA-N |
| XLogP | 4.25 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|