C21H20ClFN2O — CID 170908518
6-(4-chlorophenyl)-N-[(4-fluorophenyl)methylideneamino]-4-methylcyclohex-3-ene-1-carboxamide (PubChem CID 170908518) has the molecular formula C21H20ClFN2O and a molecular weight of 370.86 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-[(4-fluorophenyl)methylideneamino]-4-methylcyclohex-3-ene-1-carboxamide.
| Compound Name | 6-(4-chlorophenyl)-N-[(4-fluorophenyl)methylideneamino]-4-methylcyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 170908518 |
| Molecular Formula | C21H20ClFN2O |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 6-(4-chlorophenyl)-N-[(4-fluorophenyl)methylideneamino]-4-methylcyclohex-3-ene-1-carboxamide |
| SMILES | CC1=CCC(C(=O)NN=Cc2ccc(F)cc2)C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C21H20ClFN2O/c1-14-2-11-19(20(12-14)16-5-7-17(22)8-6-16)21(26)25-24-13-15-3-9-18(23)10-4-15/h2-10,13,19-20H,11-12H2,1H3,(H,25,26) |
| InChIKey | NLUZTDDFBQOLDU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|