C16H26N6S — CID 19324813
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]thiourea (PubChem CID 19324813) has the molecular formula C16H26N6S and a molecular weight of 334.49 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]thiourea.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19324813 |
| Molecular Formula | C16H26N6S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]thiourea |
| SMILES | Cc1cc(C)n(CCCNC(=S)NCc2c(C)nn(C)c2C)n1 |
| InChI | InChI=1S/C16H26N6S/c1-11-9-12(2)22(19-11)8-6-7-17-16(23)18-10-15-13(3)20-21(5)14(15)4/h9H,6-8,10H2,1-5H3,(H2,17,18,23) |
| InChIKey | IYCOYKNPFPWXSI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|