C23H35ClN6 — CID 111789388
1-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine (PubChem CID 111789388) has the molecular formula C23H35ClN6 and a molecular weight of 431.03 g/mol. Its IUPAC name is 1-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine.
| Compound Name | 1-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111789388 |
| Molecular Formula | C23H35ClN6 |
| Molecular Weight | 431.03 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 1-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCC1CCN(Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C23H35ClN6/c1-18-15-19(2)30(28-18)12-6-11-26-23(25-3)27-16-20-9-13-29(14-10-20)17-21-7-4-5-8-22(21)24/h4-5,7-8,15,20H,6,9-14,16-17H2,1-3H3,(H2,25,26,27) |
| InChIKey | YCPIASLUJGAHDK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.03 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|