C23H29ClN4OS — CID 4983370
2-[4-[(2-chlorophenyl)methylcarbamothioyl]-1,4-diazepan-1-yl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 4983370) has the molecular formula C23H29ClN4OS and a molecular weight of 445.03 g/mol. Its IUPAC name is 2-[4-[(2-chlorophenyl)methylcarbamothioyl]-1,4-diazepan-1-yl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[4-[(2-chlorophenyl)methylcarbamothioyl]-1,4-diazepan-1-yl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 4983370 |
| Molecular Formula | C23H29ClN4OS |
| Molecular Weight | 445.03 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2-[4-[(2-chlorophenyl)methylcarbamothioyl]-1,4-diazepan-1-yl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN1CCCN(C(=S)NCc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C23H29ClN4OS/c1-17-7-5-8-18(2)22(17)26-21(29)16-27-11-6-12-28(14-13-27)23(30)25-15-19-9-3-4-10-20(19)24/h3-5,7-10H,6,11-16H2,1-2H3,(H,25,30)(H,26,29) |
| InChIKey | FSISDQSTMYXMFY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.03 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|