C21H27FN4S — CID 23739841
N-[1-(4-fluorophenyl)ethyl]-4-[(6-methyl-2-pyridinyl)methyl]-1,4-diazepane-1-carbothioamide (PubChem CID 23739841) has the molecular formula C21H27FN4S and a molecular weight of 386.54 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethyl]-4-[(6-methyl-2-pyridinyl)methyl]-1,4-diazepane-1-carbothioamide.
| Compound Name | N-[1-(4-fluorophenyl)ethyl]-4-[(6-methyl-2-pyridinyl)methyl]-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 23739841 |
| Molecular Formula | C21H27FN4S |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethyl]-4-[(6-methyl-2-pyridinyl)methyl]-1,4-diazepane-1-carbothioamide |
| SMILES | Cc1cccc(CN2CCCN(C(=S)NC(C)c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C21H27FN4S/c1-16-5-3-6-20(23-16)15-25-11-4-12-26(14-13-25)21(27)24-17(2)18-7-9-19(22)10-8-18/h3,5-10,17H,4,11-15H2,1-2H3,(H,24,27) |
| InChIKey | HTSKCIFLPKQZBK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|