C20H23Cl2N3S — CID 17374587
4-[(2,6-dichlorophenyl)methyl]-N-(1-phenylethyl)piperazine-1-carbothioamide (PubChem CID 17374587) has the molecular formula C20H23Cl2N3S and a molecular weight of 408.40 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenyl)methyl]-N-(1-phenylethyl)piperazine-1-carbothioamide.
| Compound Name | 4-[(2,6-dichlorophenyl)methyl]-N-(1-phenylethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17374587 |
| Molecular Formula | C20H23Cl2N3S |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 4-[(2,6-dichlorophenyl)methyl]-N-(1-phenylethyl)piperazine-1-carbothioamide |
| SMILES | CC(NC(=S)N1CCN(Cc2c(Cl)cccc2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H23Cl2N3S/c1-15(16-6-3-2-4-7-16)23-20(26)25-12-10-24(11-13-25)14-17-18(21)8-5-9-19(17)22/h2-9,15H,10-14H2,1H3,(H,23,26) |
| InChIKey | PLPZJDHCFNECTD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|