C15H24N3S+ — CID 7130343
4-ethyl-N-[(1R)-1-phenylethyl]piperazin-4-ium-1-carbothioamide (PubChem CID 7130343) has the molecular formula C15H24N3S+ and a molecular weight of 278.44 g/mol. Its IUPAC name is 4-ethyl-N-[(1R)-1-phenylethyl]piperazin-4-ium-1-carbothioamide.
| Compound Name | 4-ethyl-N-[(1R)-1-phenylethyl]piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 7130343 |
| Molecular Formula | C15H24N3S+ |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 4-ethyl-N-[(1R)-1-phenylethyl]piperazin-4-ium-1-carbothioamide |
| SMILES | CC[NH+]1CCN(C(=S)N[C@H](C)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H23N3S/c1-3-17-9-11-18(12-10-17)15(19)16-13(2)14-7-5-4-6-8-14/h4-8,13H,3,9-12H2,1-2H3,(H,16,19)/p+1/t13-/m1/s1 |
| InChIKey | BLBKFRTWFWPMQO-CYBMUJFWSA-O |
| XLogP | 0.84 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|