C20H21N3S — CID 95571301
N-[(1R)-1-phenylethyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbothioamide (PubChem CID 95571301) has the molecular formula C20H21N3S and a molecular weight of 335.48 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbothioamide.
| Compound Name | N-[(1R)-1-phenylethyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbothioamide |
|---|---|
| PubChem CID | 95571301 |
| Molecular Formula | C20H21N3S |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbothioamide |
| SMILES | C[C@@H](NC(=S)N1CCc2[nH]c3ccccc3c2C1)c1ccccc1 |
| InChI | InChI=1S/C20H21N3S/c1-14(15-7-3-2-4-8-15)21-20(24)23-12-11-19-17(13-23)16-9-5-6-10-18(16)22-19/h2-10,14,22H,11-13H2,1H3,(H,21,24)/t14-/m1/s1 |
| InChIKey | FZEUGVKSXDJKFJ-CQSZACIVSA-N |
| XLogP | 4.16 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|