C24H27N3O2 — CID 41268205
N-[(2R,3R)-3-methyl-1-oxo-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pentan-2-yl]benzamide (PubChem CID 41268205) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is N-[(2R,3R)-3-methyl-1-oxo-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pentan-2-yl]benzamide.
| Compound Name | N-[(2R,3R)-3-methyl-1-oxo-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 41268205 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-[(2R,3R)-3-methyl-1-oxo-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pentan-2-yl]benzamide |
| SMILES | CC[C@@H](C)[C@@H](NC(=O)c1ccccc1)C(=O)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C24H27N3O2/c1-3-16(2)22(26-23(28)17-9-5-4-6-10-17)24(29)27-14-13-21-19(15-27)18-11-7-8-12-20(18)25-21/h4-12,16,22,25H,3,13-15H2,1-2H3,(H,26,28)/t16-,22-/m1/s1 |
| InChIKey | AEFFIEOELBIEIS-OPAMFIHVSA-N |
| XLogP | 3.90 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|