C11H24N3S+ — CID 7130336
N-[(2S)-butan-2-yl]-4-ethylpiperazin-4-ium-1-carbothioamide (PubChem CID 7130336) has the molecular formula C11H24N3S+ and a molecular weight of 230.40 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-4-ethylpiperazin-4-ium-1-carbothioamide.
| Compound Name | N-[(2S)-butan-2-yl]-4-ethylpiperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 7130336 |
| Molecular Formula | C11H24N3S+ |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | N-[(2S)-butan-2-yl]-4-ethylpiperazin-4-ium-1-carbothioamide |
| SMILES | CC[C@H](C)NC(=S)N1CC[NH+](CC)CC1 |
| InChI | InChI=1S/C11H23N3S/c1-4-10(3)12-11(15)14-8-6-13(5-2)7-9-14/h10H,4-9H2,1-3H3,(H,12,15)/p+1/t10-/m0/s1 |
| InChIKey | GUYGSWQUGVKSAM-JTQLQIEISA-O |
| XLogP | -0.12 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|