C13H25N3O4S — CID 171700101
N-butan-2-yl-4-ethylpiperazine-1-carbothioamide;oxalic acid (PubChem CID 171700101) has the molecular formula C13H25N3O4S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-butan-2-yl-4-ethylpiperazine-1-carbothioamide;oxalic acid.
| Compound Name | N-butan-2-yl-4-ethylpiperazine-1-carbothioamide;oxalic acid |
|---|---|
| PubChem CID | 171700101 |
| Molecular Formula | C13H25N3O4S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-butan-2-yl-4-ethylpiperazine-1-carbothioamide;oxalic acid |
| SMILES | CCC(C)NC(=S)N1CCN(CC)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H23N3S.C2H2O4/c1-4-10(3)12-11(15)14-8-6-13(5-2)7-9-14;3-1(4)2(5)6/h10H,4-9H2,1-3H3,(H,12,15);(H,3,4)(H,5,6) |
| InChIKey | BAULUKSJWDBTMO-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|