C15H27N5S — CID 19291721
N-butan-2-yl-4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazine-1-carbothioamide (PubChem CID 19291721) has the molecular formula C15H27N5S and a molecular weight of 309.48 g/mol. Its IUPAC name is N-butan-2-yl-4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-butan-2-yl-4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19291721 |
| Molecular Formula | C15H27N5S |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | N-butan-2-yl-4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazine-1-carbothioamide |
| SMILES | CCC(C)NC(=S)N1CCN(Cc2cn(C)nc2C)CC1 |
| InChI | InChI=1S/C15H27N5S/c1-5-12(2)16-15(21)20-8-6-19(7-9-20)11-14-10-18(4)17-13(14)3/h10,12H,5-9,11H2,1-4H3,(H,16,21) |
| InChIKey | AIRRZOVPCABIJQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|