C22H29N7S — CID 19291753
4-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide (PubChem CID 19291753) has the molecular formula C22H29N7S and a molecular weight of 423.59 g/mol. Its IUPAC name is 4-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide.
| Compound Name | 4-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19291753 |
| Molecular Formula | C22H29N7S |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 4-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide |
| SMILES | Cc1ccc(Cn2cc(NC(=S)N3CCN(Cc4cn(C)nc4C)CC3)cn2)cc1 |
| InChI | InChI=1S/C22H29N7S/c1-17-4-6-19(7-5-17)13-29-16-21(12-23-29)24-22(30)28-10-8-27(9-11-28)15-20-14-26(3)25-18(20)2/h4-7,12,14,16H,8-11,13,15H2,1-3H3,(H,24,30) |
| InChIKey | KLDIFBDNGUGZLL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 54.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|