C22H28ClN7S — CID 19289692
4-[(4-chlorophenyl)methyl]-N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide (PubChem CID 19289692) has the molecular formula C22H28ClN7S and a molecular weight of 458.04 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide.
| Compound Name | 4-[(4-chlorophenyl)methyl]-N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19289692 |
| Molecular Formula | C22H28ClN7S |
| Molecular Weight | 458.04 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-N-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide |
| SMILES | CCn1ncc(Cn2cc(NC(=S)N3CCN(Cc4ccc(Cl)cc4)CC3)cn2)c1C |
| InChI | InChI=1S/C22H28ClN7S/c1-3-30-17(2)19(12-25-30)15-29-16-21(13-24-29)26-22(31)28-10-8-27(9-11-28)14-18-4-6-20(23)7-5-18/h4-7,12-13,16H,3,8-11,14-15H2,1-2H3,(H,26,31) |
| InChIKey | HOHLDUJUSSMLED-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 54.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.04 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|