C15H28N4O2 — CID 108944495
1,3-bis(4-ethylpiperazin-1-yl)propane-1,3-dione (PubChem CID 108944495) has the molecular formula C15H28N4O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 1,3-bis(4-ethylpiperazin-1-yl)propane-1,3-dione.
| Compound Name | 1,3-bis(4-ethylpiperazin-1-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 108944495 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 1,3-bis(4-ethylpiperazin-1-yl)propane-1,3-dione |
| SMILES | CCN1CCN(C(=O)CC(=O)N2CCN(CC)CC2)CC1 |
| InChI | InChI=1S/C15H28N4O2/c1-3-16-5-9-18(10-6-16)14(20)13-15(21)19-11-7-17(4-2)8-12-19/h3-13H2,1-2H3 |
| InChIKey | NIEHFPRIWUOHNN-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|