C9H20N2S — CID 5366322
1,3-di(butan-2-yl)thiourea (PubChem CID 5366322) has the molecular formula C9H20N2S and a molecular weight of 188.34 g/mol. Its IUPAC name is 1,3-di(butan-2-yl)thiourea.
| Compound Name | 1,3-di(butan-2-yl)thiourea |
|---|---|
| PubChem CID | 5366322 |
| Molecular Formula | C9H20N2S |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1,3-di(butan-2-yl)thiourea |
| SMILES | CCC(C)NC(=S)NC(C)CC |
| InChI | InChI=1S/C9H20N2S/c1-5-7(3)10-9(12)11-8(4)6-2/h7-8H,5-6H2,1-4H3,(H2,10,11,12) |
| InChIKey | QTOGVESSTRJHKB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|