C10H20N2OS — CID 19187679
N-(butan-2-ylcarbamothioyl)-2,2-dimethylpropanamide (PubChem CID 19187679) has the molecular formula C10H20N2OS and a molecular weight of 216.35 g/mol. Its IUPAC name is N-(butan-2-ylcarbamothioyl)-2,2-dimethylpropanamide.
| Compound Name | N-(butan-2-ylcarbamothioyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 19187679 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-(butan-2-ylcarbamothioyl)-2,2-dimethylpropanamide |
| SMILES | CCC(C)NC(=S)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C10H20N2OS/c1-6-7(2)11-9(14)12-8(13)10(3,4)5/h7H,6H2,1-5H3,(H2,11,12,13,14) |
| InChIKey | RVKJACJZQCNDKA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|