C16H25N3O3S2 — CID 17160323
N-[[4-(butan-2-ylsulfamoyl)phenyl]carbamothioyl]-2,2-dimethylpropanamide (PubChem CID 17160323) has the molecular formula C16H25N3O3S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-[[4-(butan-2-ylsulfamoyl)phenyl]carbamothioyl]-2,2-dimethylpropanamide.
| Compound Name | N-[[4-(butan-2-ylsulfamoyl)phenyl]carbamothioyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 17160323 |
| Molecular Formula | C16H25N3O3S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[[4-(butan-2-ylsulfamoyl)phenyl]carbamothioyl]-2,2-dimethylpropanamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(NC(=S)NC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H25N3O3S2/c1-6-11(2)19-24(21,22)13-9-7-12(8-10-13)17-15(23)18-14(20)16(3,4)5/h7-11,19H,6H2,1-5H3,(H2,17,18,20,23) |
| InChIKey | HSGZELFCCHBTPX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|