C15H20N4O2S2 — CID 4659447
N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-2,2-dimethylpropanamide (PubChem CID 4659447) has the molecular formula C15H20N4O2S2 and a molecular weight of 352.49 g/mol. Its IUPAC name is N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-2,2-dimethylpropanamide.
| Compound Name | N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 4659447 |
| Molecular Formula | C15H20N4O2S2 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-2,2-dimethylpropanamide |
| SMILES | CC(=O)NC(=S)Nc1ccc(NC(=S)NC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H20N4O2S2/c1-9(20)16-13(22)17-10-5-7-11(8-6-10)18-14(23)19-12(21)15(2,3)4/h5-8H,1-4H3,(H2,16,17,20,22)(H2,18,19,21,23) |
| InChIKey | QKDSKQQJIKVVKS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|