C20H22ClN3O3S2 — CID 17195825
(E)-N-[[4-(butan-2-ylsulfamoyl)phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 17195825) has the molecular formula C20H22ClN3O3S2 and a molecular weight of 452.00 g/mol. Its IUPAC name is (E)-N-[[4-(butan-2-ylsulfamoyl)phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[4-(butan-2-ylsulfamoyl)phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17195825 |
| Molecular Formula | C20H22ClN3O3S2 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | (E)-N-[[4-(butan-2-ylsulfamoyl)phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(NC(=S)NC(=O)/C=C/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H22ClN3O3S2/c1-3-14(2)24-29(26,27)18-11-9-17(10-12-18)22-20(28)23-19(25)13-6-15-4-7-16(21)8-5-15/h4-14,24H,3H2,1-2H3,(H2,22,23,25,28)/b13-6+ |
| InChIKey | SFCYCMLYKFMXOJ-AWNIVKPZSA-N |
| XLogP | 3.94 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|