C24H22ClN3O3S2 — CID 17195645
(E)-N-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 17195645) has the molecular formula C24H22ClN3O3S2 and a molecular weight of 500.05 g/mol. Its IUPAC name is (E)-N-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17195645 |
| Molecular Formula | C24H22ClN3O3S2 |
| Molecular Weight | 500.05 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | (E)-N-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc(NC(=S)NC(=O)/C=C/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H22ClN3O3S2/c1-28(17-19-5-3-2-4-6-19)33(30,31)22-14-12-21(13-15-22)26-24(32)27-23(29)16-9-18-7-10-20(25)11-8-18/h2-16H,17H2,1H3,(H2,26,27,29,32)/b16-9+ |
| InChIKey | UJNQRDPVGUOSBC-CXUHLZMHSA-N |
| XLogP | 4.69 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.05 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|