C23H21N3O3S2 — CID 4778490
N-[[4-[methyl(phenyl)sulfamoyl]phenyl]carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 4778490) has the molecular formula C23H21N3O3S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-[[4-[methyl(phenyl)sulfamoyl]phenyl]carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | N-[[4-[methyl(phenyl)sulfamoyl]phenyl]carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 4778490 |
| Molecular Formula | C23H21N3O3S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N-[[4-[methyl(phenyl)sulfamoyl]phenyl]carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc(NC(=S)NC(=O)C=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N3O3S2/c1-26(20-10-6-3-7-11-20)31(28,29)21-15-13-19(14-16-21)24-23(30)25-22(27)17-12-18-8-4-2-5-9-18/h2-17H,1H3,(H2,24,25,27,30) |
| InChIKey | WUPNESHBXJIFRO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|