C15H32N4S2 — CID 29057493
1-[(2R)-butan-2-yl]-3-[3-[[(2R)-butan-2-yl]carbamothioylamino]-2,2-dimethylpropyl]thiourea (PubChem CID 29057493) has the molecular formula C15H32N4S2 and a molecular weight of 332.58 g/mol. Its IUPAC name is 1-[(2R)-butan-2-yl]-3-[3-[[(2R)-butan-2-yl]carbamothioylamino]-2,2-dimethylpropyl]thiourea.
| Compound Name | 1-[(2R)-butan-2-yl]-3-[3-[[(2R)-butan-2-yl]carbamothioylamino]-2,2-dimethylpropyl]thiourea |
|---|---|
| PubChem CID | 29057493 |
| Molecular Formula | C15H32N4S2 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 1-[(2R)-butan-2-yl]-3-[3-[[(2R)-butan-2-yl]carbamothioylamino]-2,2-dimethylpropyl]thiourea |
| SMILES | CC[C@@H](C)NC(=S)NCC(C)(C)CNC(=S)N[C@H](C)CC |
| InChI | InChI=1S/C15H32N4S2/c1-7-11(3)18-13(20)16-9-15(5,6)10-17-14(21)19-12(4)8-2/h11-12H,7-10H2,1-6H3,(H2,16,18,20)(H2,17,19,21)/t11-,12-/m1/s1 |
| InChIKey | GGYUKBKAQFNASM-VXGBXAGGSA-N |
| XLogP | 2.54 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|